![5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-amine (CAS: 884497-40-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0744372.png "5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-amine chemical structure")
5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-amine
Catalog No: FT-0744372
CAS No: 884497-40-9
- Chemical Name: 5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-amine
- Molecular Formula: C10H9FN2S
- Molecular Weight: 208.26
- InChI Key: TZTVOZBUYKWEMJ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9FN2S/c11-8-3-1-2-7(4-8)5-9-6-13-10(12)14-9/h1-4,6H,5H2,(H2,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 884497-40-9 |
|---|---|
| MF: | C10H9FN2S |
| Density: | 1.317g/cm3 |
| Flash_Point: | 163.2ºC |
| Melting_Point: | N/A |
| Product_Name: | 5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-amine |
| Symbol: | GHS07 |
| Bolling_Point: | 346.2ºC at 760 mmHg |
| FW: | 208.25500 |
| Density: | 1.317g/cm3 |
|---|---|
| MF: | C10H9FN2S |
| LogP: | 3.03640 |
| Exact_Mass: | 208.04700 |
| Bolling_Point: | 346.2ºC at 760 mmHg |
| Flash_Point: | 163.2ºC |
| FW: | 208.25500 |
| Refractive_Index: | 1.63 |
| PSA: | 67.15000 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
